CAS 34379-53-8 appears in our catalog under these names: 3,4-Dichloro-1-(4-methoxyphenyl)-1H-pyrrole-2,5-dione, 98%, 98%, 3,4-Dichloro-1-(4-methoxyphenyl)-1H-pyrrole-2,5-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,4-dichloro-1-(4-methoxyphenyl)pyrrole-2,5-dione (CAS 34379-53-8) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3,4-dichloro-1-(4-methoxyphenyl)pyrrole-2,5-dione. InChIKey: YVTFIECPUFOBMZ-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3,4-dichloro-1-(4-methoxyphenyl)pyrrole-2,5-dione |
| InChIKey | YVTFIECPUFOBMZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)