CAS 3449-63-6 appears in our catalog under these names: 3–(4–Fluorophenyl)pentanedioic acid, 3-(4-Fluorophenyl)pentanedioic acid, 95%, 95%, 3-(4-Fluorophenyl)pentanedioic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-(4-fluorophenyl)pentanedioic acid (CAS 3449-63-6) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 3-(4-fluorophenyl)pentanedioic acid. InChIKey: CNZZQTFKXGQNLI-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 3-(4-fluorophenyl)pentanedioic acid |
| InChIKey | CNZZQTFKXGQNLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CC(=O)O)F |
Computed by PubChem (NCBI)