CAS 3463-43-2 is the registry number for 1,4-Dichloro-2,5-dimethyl-3-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
1,4-dichloro-2,5-dimethyl-3-nitrobenzene (CAS 3463-43-2) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 1,4-dichloro-2,5-dimethyl-3-nitrobenzene. InChIKey: BGBKSOLUHNXPOJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 1,4-dichloro-2,5-dimethyl-3-nitrobenzene |
| InChIKey | BGBKSOLUHNXPOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)[N+](=O)[O-])C)Cl |
Computed by PubChem (NCBI)