Products 347840-02-2
CAS 347840-02-2 appears in our catalog under these names: Benzyl-2,3,4,5,6-d5 trans-Cinnamate, 98 atom % D, min 98% Chemical Purity, Benzyl cinnamate–d5, Benzyl cinnamate-d5, 98.15%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1mg, 10mg, 5mg, 1 mg, 25 mg, 5 mg.
(2,3,4,5,6-pentadeuteriophenyl)methyl (E)-3-phenylprop-2-enoate (CAS 347840-02-2) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 243.31 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methyl (E)-3-phenylprop-2-enoate. InChIKey: NGHOLYJTSCBCGC-MAOTZQGHSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 243.31 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methyl (E)-3-phenylprop-2-enoate |
| InChIKey | NGHOLYJTSCBCGC-MAOTZQGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)/C=C/C2=CC=CC=C2)[2H])[2H] |
Computed by PubChem (NCBI)