Products 35599-99-6
CAS 35599-99-6 appears in our catalog under these names: 2-(2,3-Dichlorophenyl)-2-methoxyacetic acid 95%, 2-(2,3-Dichlorophenyl)-2-methoxyacetic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2,3-dichlorophenyl)-2-methoxyacetic acid (CAS 35599-99-6) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-2-methoxyacetic acid. InChIKey: IMYXMAHJWKKFLS-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-2-methoxyacetic acid |
| InChIKey | IMYXMAHJWKKFLS-UHFFFAOYSA-N |
| SMILES | COC(C1=C(C(=CC=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2,3-dichlorophenyl)-2-methoxyacetic acid, Benzeneacetic acid, 2,3-dichloro-alpha-methoxy-, (2,3-dichlorophenyl)(methoxy)acetic acid, 2,3-Dichloro-I+/--methoxybenzeneacetic acid, Benzeneacetic acid, 2,3-dichloro-?-methoxy-, 2-(2,3-dichlorophenyl)-2-methoxy-acetic acid, Benzeneacetic acid, 2,3-dichloro-|A-methoxy-