Products 3588-64-5

CAS 3588-64-5 is the registry number for 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid (CAS 3588-64-5) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid. InChIKey: VAYRSTHMTWUHGE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO4
Molecular weight295.29 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid
InChIKeyVAYRSTHMTWUHGE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)O)N2C(=O)C3=CC=CC=C3C2=O

Computed by PubChem (NCBI)