Products 216681-74-2
CAS 216681-74-2 appears in our catalog under these names: 1,3-Dioxo-2-(1-phenylethyl)isoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-(1-phenylethyl)isoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,3-dioxo-2-(1-phenylethyl)isoindole-5-carboxylic acid (CAS 216681-74-2) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 1,3-dioxo-2-(1-phenylethyl)isoindole-5-carboxylic acid. InChIKey: ZLRNOMMOXNXUPS-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 1,3-dioxo-2-(1-phenylethyl)isoindole-5-carboxylic acid |
| InChIKey | ZLRNOMMOXNXUPS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)