Products 166096-57-7

CAS 166096-57-7 is the registry number for 1,3-Dioxo-2-phenethyl-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylic acid (CAS 166096-57-7) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylic acid. InChIKey: ICDZUDIRGRAYIV-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO4
Molecular weight295.29 g/mol
IUPAC name1,3-dioxo-2-(2-phenylethyl)isoindole-5-carboxylic acid
InChIKeyICDZUDIRGRAYIV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O

Computed by PubChem (NCBI)