CAS 294667-08-6 appears in our catalog under these names: 2-(2,3-Dimethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2–(2,3–Dimethylphenyl)–1,3–dioxo–5–isoindolinecarboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g.
2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 294667-08-6) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: OHGUIZGDCCILFX-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-(2,3-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | OHGUIZGDCCILFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)