Products 35975-95-2
CAS 35975-95-2 is the registry number for 6-Benzyloxy-4-hydroxy-quinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylic acid (CAS 35975-95-2) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylic acid. InChIKey: BJZQPNHESNGXAR-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylic acid |
| InChIKey | BJZQPNHESNGXAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C(C3=O)C(=O)O |
Computed by PubChem (NCBI)