CAS 690671-26-2 is the registry number for 2-(2-Ethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-ethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 690671-26-2) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-(2-ethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: VFPCVSBORBLUMB-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-(2-ethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | VFPCVSBORBLUMB-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)