CAS 306320-92-3 appears in our catalog under these names: 2-(2,5-Dimethyl-phenyl)-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%, 2-(2,5-Dimethylphenyl)-1,3-dioxo-5-isoindolinecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 306320-92-3) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: SIWXMKDPCUAHIK-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | SIWXMKDPCUAHIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)