Products 29037-77-2
CAS 29037-77-2 appears in our catalog under these names: 2-(4-(1-Benzofuran-2-amido)phenyl)acetic acid, 2-[4-(1-Benzofuran-2-amido)phenyl]acetic acid, 95%, 2-(4-(1-Benzofuran-2-amido)phenyl)acetic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 100mg.
2-[4-(1-benzofuran-2-carbonylamino)phenyl]acetic acid (CAS 29037-77-2) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-[4-(1-benzofuran-2-carbonylamino)phenyl]acetic acid. InChIKey: DHAXIWDRNDXVNO-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-[4-(1-benzofuran-2-carbonylamino)phenyl]acetic acid |
| InChIKey | DHAXIWDRNDXVNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)NC3=CC=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)