CAS 36043-49-9 is the registry number for 2-Amino-9,10-dihydrophenanthrene-9,10-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-aminophenanthrene-9,10-dione (CAS 36043-49-9) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 2-aminophenanthrene-9,10-dione. InChIKey: HENHQTJCDFNZOI-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-aminophenanthrene-9,10-dione |
| InChIKey | HENHQTJCDFNZOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)N)C(=O)C2=O |
Computed by PubChem (NCBI)