Products 362606-19-7

CAS 362606-19-7 appears in our catalog under these names: 1,6–Naphthyridine–8–carboxylic acid, 1,6-Naphthyridine-8-carboxylic acid, 1,6-Naphthyridine-8-carboxylic acid 98%, 1,6-Naphthyridine-8-carboxylic acid, 98%, 98%, 1,6-Naphthyridine-8-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g, 500mg.

Structural formula: {0} (CAS {1})

1,6-naphthyridine-8-carboxylic acid (CAS 362606-19-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,6-naphthyridine-8-carboxylic acid. InChIKey: WERVZPSGADOFEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2
Molecular weight174.16 g/mol
IUPAC name1,6-naphthyridine-8-carboxylic acid
InChIKeyWERVZPSGADOFEJ-UHFFFAOYSA-N
SMILESC1=CC2=CN=CC(=C2N=C1)C(=O)O

Computed by PubChem (NCBI)