CAS 36716-71-9 is the registry number for 4-(4-Chlorophenyl)-4-hydroxycyclohexanone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
4-(4-chlorophenyl)-4-hydroxycyclohexan-1-one (CAS 36716-71-9) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-hydroxycyclohexan-1-one. InChIKey: WEMZPTVFMJNMRK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-hydroxycyclohexan-1-one |
| InChIKey | WEMZPTVFMJNMRK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)