Products 37102-74-2
CAS 37102-74-2 appears in our catalog under these names: 3-Methylphthalic acid, 95%, 3-Methylphthalic Acid, 3–Methylphthalic acid, 3-Methylphthalic acid 95%, 3-Methylphthalic Acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g, 25g, 100g.
3-methylphthalic acid (CAS 37102-74-2) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-methylphthalic acid. InChIKey: IBFJDBNISOJRCW-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-methylphthalic acid |
| InChIKey | IBFJDBNISOJRCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methylphthalate, 3-Methylbenzene-1,2-dicarboxylic acid, 1,2-Benzenedicarboxylic acid, 3-methyl-, 3-methylbenzene-1,2-dicarboxylate, 3-Methyl-1,2-benzenedicarboxylic Acid; 3-Methyl-phthalic Acid, 3-Methyl-1,2-benzenedicarboxylic acid, 3-methyl phthalic acid, 3-methyl-phthalic acid, 3-Methylphthalic acid - [M71805]