CAS 374914-83-7 is the registry number for 2-Chloro-1-(2,3-dimethyl-1H-indol-1-yl)propan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(2,3-dimethylindol-1-yl)propan-1-one (CAS 374914-83-7) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 2-chloro-1-(2,3-dimethylindol-1-yl)propan-1-one. InChIKey: JUALFISVFJJIRZ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-chloro-1-(2,3-dimethylindol-1-yl)propan-1-one |
| InChIKey | JUALFISVFJJIRZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=CC=CC=C12)C(=O)C(C)Cl)C |
Computed by PubChem (NCBI)