CAS 37531-32-1 is the registry number for 3-Amino-4-phenoxybenzoic Acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2,5g, 250mg.
3-amino-4-phenoxybenzoic acid (CAS 37531-32-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-amino-4-phenoxybenzoic acid. InChIKey: BBCRLBBRTVEVSP-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-amino-4-phenoxybenzoic acid |
| InChIKey | BBCRLBBRTVEVSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)C(=O)O)N |
Computed by PubChem (NCBI)