CAS 376592-93-7 appears in our catalog under these names: Eltrombopag Impurity 10, 3’-Amino-2’-Hydroxy-(1,1’)biphenyl-3-carboxylic Acid, >95% (HPLC), 3'–Amino–2'–hydroxybiphenyl–3–carboxylic Acid, 3'-Amino-2'-hydroxybiphenyl-3-carboxylic Acid, >98.0%(HPLC)(T), 3'-Amino-2'-hydroxy-[1,1'-biphenyl]-3-carboxylic acid 97%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 10g, 1g, 5g, 200mg, 100mg.
3-(3-amino-2-hydroxyphenyl)benzoic acid (CAS 376592-93-7) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-(3-amino-2-hydroxyphenyl)benzoic acid. InChIKey: ZXLYSSHNDUXXIN-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-(3-amino-2-hydroxyphenyl)benzoic acid |
| InChIKey | ZXLYSSHNDUXXIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C(C(=CC=C2)N)O |
Computed by PubChem (NCBI)