CAS 37908-97-7 appears in our catalog under these names: 3,5-Dichloro-4-methoxybenzoic acid, 97%, 97%, 3,5-Dichloro-4-methoxybenzoic acid 97%, 3,5-dichloro-4-methoxybenzoic acid, 97%, 3,5–Dichloro–4–methoxybenzoic acid, 3,5-Dichloro-4-methoxybenzoic acid. Offered by: Chemat, Ambeed, Fluorochem, GLPBio, Biosynth. Available pack sizes: 1kg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
3,5-dichloro-4-methoxybenzoic acid (CAS 37908-97-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,5-dichloro-4-methoxybenzoic acid. InChIKey: XSYZTYQXKIXPRC-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 3,5-dichloro-4-methoxybenzoic acid |
| InChIKey | XSYZTYQXKIXPRC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)