CAS 38153-01-4 appears in our catalog under these names: Naphthalene–1,4–dicarboxaldehyde, Naphthalene-1,4-dicarbaldehyde 98%, naphthalene-1,4-dicarbaldehyde, 98%, 98%, Naphthalene-1,4-dicarboxaldehyde, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
Naphthalene-1,4-dicarbaldehyde (CAS 38153-01-4) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-1,4-dicarbaldehyde. InChIKey: XUFLAVKRRLBIMV-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-1,4-dicarbaldehyde |
| InChIKey | XUFLAVKRRLBIMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=CC=C(C2=C1)C=O)C=O |
Computed by PubChem (NCBI)