CAS 3839-18-7 appears in our catalog under these names: 3-Cyano-1-naphthoic acid, 97%, 3-Cyanonaphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-cyanonaphthalene-1-carboxylic acid (CAS 3839-18-7) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 3-cyanonaphthalene-1-carboxylic acid. InChIKey: UZINDHOUKODBOO-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 3-cyanonaphthalene-1-carboxylic acid |
| InChIKey | UZINDHOUKODBOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2C(=O)O)C#N |
Computed by PubChem (NCBI)