CAS 3839-20-1 appears in our catalog under these names: 5-Cyano-1-naphthoic acid, 97%, 5-Cyanonaphthalene-1-carboxylic acid, 98%, 5-Cyanonaphthalene-1-carboxylic acid, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
5-cyanonaphthalene-1-carboxylic acid (CAS 3839-20-1) is a chemical compound with the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. IUPAC name: 5-cyanonaphthalene-1-carboxylic acid. InChIKey: YBVPGIIGESADCT-UHFFFAOYSA-N.
| Molecular formula | C12H7NO2 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 5-cyanonaphthalene-1-carboxylic acid |
| InChIKey | YBVPGIIGESADCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)