Products 3846-50-2
CAS 3846-50-2 is the registry number for N-ethyl-2,4-dinitroaniline. Offered by: TRC. Available pack sizes: 1g.
N-ethyl-2,4-dinitroaniline (CAS 3846-50-2) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: N-ethyl-2,4-dinitroaniline. InChIKey: YYOUTZBUOQBAAE-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | N-ethyl-2,4-dinitroaniline |
| InChIKey | YYOUTZBUOQBAAE-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
N-Ethyl-2,4-dinitroaniline, Benzenamine, N-ethyl-2,4-dinitro-, 2,4-Dinitro-N-ethylaniline, N-Ethyl-2,4-dinitro-aniline, Benzenamine,N-ethyl-2,4-dinitro-, (2,4-dinitrophenyl)ethylamine, N-Ethyl-2,4-dinitroaniline #, aniline, N-ethyl-2,4-dinitro-, InChI=1/C8H9N3O4/c1-2-9-7-4-3-6(10(12)13)5-8(7)11(14)15/h3-5,9H,2H2,1H