CAS 38759-03-4 is the registry number for 3,7-Dimethyl-6-thioxanthine. Offered by: TRC. Available pack sizes: 50mg.
3,7-dimethyl-6-sulfanylidenepurin-2-one (CAS 38759-03-4) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 3,7-dimethyl-6-sulfanylidenepurin-2-one. InChIKey: SKDLEARFTLHAKG-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 3,7-dimethyl-6-sulfanylidenepurin-2-one |
| InChIKey | SKDLEARFTLHAKG-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=S)NC(=O)N2C |
Computed by PubChem (NCBI)