Products 38940-60-2
CAS 38940-60-2 is the registry number for 9H-pyrido[3,4-b]indole-1-carboxamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
9H-pyrido[3,4-b]indole-1-carboxamide (CAS 38940-60-2) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 9H-pyrido[3,4-b]indole-1-carboxamide. InChIKey: JUXJIYPXDYCRKZ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 9H-pyrido[3,4-b]indole-1-carboxamide |
| InChIKey | JUXJIYPXDYCRKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C(=O)N |
Computed by PubChem (NCBI)