Products 390815-42-6
CAS 390815-42-6 is the registry number for Methyl 2-amino-2-(3,4-dimethoxyphenyl)acetate hydrochloride, 95%. Offered by: BLDpharm, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg.
Methyl 2-amino-2-(3,4-dimethoxyphenyl)acetate;hydrochloride (CAS 390815-42-6) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: methyl 2-amino-2-(3,4-dimethoxyphenyl)acetate;hydrochloride. InChIKey: GTRQDGWJRZHHKV-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | methyl 2-amino-2-(3,4-dimethoxyphenyl)acetate;hydrochloride |
| InChIKey | GTRQDGWJRZHHKV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(=O)OC)N)OC.Cl |
Computed by PubChem (NCBI)