CAS 392-25-6 appears in our catalog under these names: 2,6–Difluoro–4–nitroanisole, 2,6-Difluoro-4-nitroanisole 98%, 2,6-Difluoro-4-nitroanisole, 98%, 98%, 3,5-Difluoro-4-methoxynitrobenzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g.
1,3-difluoro-2-methoxy-5-nitrobenzene (CAS 392-25-6) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 1,3-difluoro-2-methoxy-5-nitrobenzene. InChIKey: HHWLNWSVKHLZDB-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 1,3-difluoro-2-methoxy-5-nitrobenzene |
| InChIKey | HHWLNWSVKHLZDB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)