Products 3984-34-7
CAS 3984-34-7 appears in our catalog under these names: 4-(4-Chlorophenyl)-4-oxobutanoic Acid (3-(4-Chlorobenzoyl)propionic Acid), 3–(4–Chlorobenzoyl)propionic Acid, 3-(4-Chlorobenzoyl)propionic Acid, >98.0%(HPLC)(T), 3-(4-Chlorobenzoyl)propionic acid 98%, 3-(4-Chlorobenzoyl)propionic acid 95%. Offered by: Mikromol, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25mg, 100mg, 100g, 25g, 1g, 5g, 500g, 10g.
4-(4-chlorophenyl)-4-oxobutanoic acid (CAS 3984-34-7) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-oxobutanoic acid. InChIKey: AHVASTJJVAYFPY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | AHVASTJJVAYFPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
3-(4-Chlorobenzoyl)propionic acid, Benzenebutanoic acid, 4-chloro-gamma-oxo-, beta-(p-Chlorobenzoyl)propionic acid, .beta.-[p-Chlorobenzoyl]propionic acid, Benzenebutanoic acid, 4-chloro-.gamma.-oxo-, AHVASTJJVAYFPY-UHFFFAOYSA-N, InChI=1/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14, 4-(4-Chlorophenyl)-4-oxobutanoic acid, 3-(4-chlorobenzoyl)Propanoic acid, NCIStruc2_000239