CAS 40153-87-5 is the registry number for METHYL 6-METHOXY-1-OXO-1,2,3,4-TETRAHYDRONAPHTHALENE-2-CARBOXYLATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 6-methoxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate (CAS 40153-87-5) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: methyl 6-methoxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate. InChIKey: ZMHYDSAWFKQVKL-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | methyl 6-methoxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate |
| InChIKey | ZMHYDSAWFKQVKL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(CC2)C(=O)OC |
Computed by PubChem (NCBI)