CAS 4023-81-8 appears in our catalog under these names: 1–(4–Bromophenyl)–1,3–butanedione, 1-(4-Bromophenyl)-1,3-butanedione, >98.0%(GC)(T), 1-(4-Bromophenyl)-1,3-butanedione, 1-(4-Bromophenyl)butane-1,3-dione 98%, 1-(4-Bromophenyl)butane-1,3-dione, 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
1-(4-bromophenyl)butane-1,3-dione (CAS 4023-81-8) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 1-(4-bromophenyl)butane-1,3-dione. InChIKey: GIKXMINIUUFRFD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-(4-bromophenyl)butane-1,3-dione |
| InChIKey | GIKXMINIUUFRFD-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)