CAS 40296-46-6 appears in our catalog under these names: Ethyl 4,6-dichloronicotinate, 98%, 4,6-Dichloropyridine-3-carboxylic acid ethyl ester, Ethyl 4,6-dichloronicotinate, 95% , Ethyl 4,6-dichloronicotinate, Ethyl 4,6-Dichloronicotinate, >98.0%(GC). Offered by: Combi-blocks, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 25g, 100g, 1g, 500g, 1000g, 10g, 50g.
Ethyl 4,6-dichloropyridine-3-carboxylate (CAS 40296-46-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 4,6-dichloropyridine-3-carboxylate. InChIKey: AAUBVINEXCCXOK-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 4,6-dichloropyridine-3-carboxylate |
| InChIKey | AAUBVINEXCCXOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1Cl)Cl |
Computed by PubChem (NCBI)