CAS 408340-39-6 is the registry number for 2,5-Dibromo-1-methyl-3-nitrobenzene, 97%. Offered by: AmBeed. Available pack sizes: 10g.
2,5-dibromo-1-methyl-3-nitrobenzene (CAS 408340-39-6) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2,5-dibromo-1-methyl-3-nitrobenzene. InChIKey: NQAFPSSLVAEYCQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2,5-dibromo-1-methyl-3-nitrobenzene |
| InChIKey | NQAFPSSLVAEYCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)