CAS 41110-27-4 is the registry number for Pyrazine-2,5-dicarboxamide, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Pyrazine-2,5-dicarboxamide (CAS 41110-27-4) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: pyrazine-2,5-dicarboxamide. InChIKey: CLLHVSIBXXMHJI-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | pyrazine-2,5-dicarboxamide |
| InChIKey | CLLHVSIBXXMHJI-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)