Products 41110-27-4

CAS 41110-27-4 is the registry number for Pyrazine-2,5-dicarboxamide, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

Pyrazine-2,5-dicarboxamide (CAS 41110-27-4) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: pyrazine-2,5-dicarboxamide. InChIKey: CLLHVSIBXXMHJI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N4O2
Molecular weight166.14 g/mol
IUPAC namepyrazine-2,5-dicarboxamide
InChIKeyCLLHVSIBXXMHJI-UHFFFAOYSA-N
SMILESC1=C(N=CC(=N1)C(=O)N)C(=O)N

Computed by PubChem (NCBI)