CAS 41462-32-2 appears in our catalog under these names: Norepinephrine Impurity 32 HCl, 1,2,3,4-Tetrahydro-4,6,7-isoquinolinetriol Hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 75mg, 0,05g.
1,2,3,4-tetrahydroisoquinoline-4,6,7-triol;hydrochloride (CAS 41462-32-2) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-4,6,7-triol;hydrochloride. InChIKey: YBHZYQMJVSTXMC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-4,6,7-triol;hydrochloride |
| InChIKey | YBHZYQMJVSTXMC-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC(=C(C=C2CN1)O)O)O.Cl |
Computed by PubChem (NCBI)