Products 42057-30-7
CAS 42057-30-7 is the registry number for 2-Amino-2-(2,6-dichlorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-2-(2,6-dichlorophenyl)acetic acid (CAS 42057-30-7) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2-amino-2-(2,6-dichlorophenyl)acetic acid. InChIKey: CEAIBRZKLBUDQF-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-amino-2-(2,6-dichlorophenyl)acetic acid |
| InChIKey | CEAIBRZKLBUDQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(=O)O)N)Cl |
Computed by PubChem (NCBI)