CAS 42523-15-9 is the registry number for 1-Methoxy-9H-fluoren-9-one. Offered by: TRC. Available pack sizes: 1g.
1-methoxyfluoren-9-one (CAS 42523-15-9) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 1-methoxyfluoren-9-one. InChIKey: ZLYUKFUCNSKIKR-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-methoxyfluoren-9-one |
| InChIKey | ZLYUKFUCNSKIKR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)