Products 42710-39-4
CAS 42710-39-4 appears in our catalog under these names: 2-Methyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-Methyl-1,3-dioxo-2,3-dihydro-1 H -isoindole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
2-methyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 42710-39-4) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 2-methyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: JNOGAXDCJSTIRH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-methyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | JNOGAXDCJSTIRH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-methyl-1,3-dioxoisoindoline-5-carboxylic acid, 2-methyl-1,3-dioxoisoindole-5-carboxylic acid, 2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid, 2-methyl-1,3-dioxo-5-isoindolinecarboxylic acid, Cambridge id 6555449, JNOGAXDCJSTIRH-UHFFFAOYSA-N, 2-methyl-1,3-dioxo-2,3-dihydro-1 h-isoindole-5-carboxylic acid, 2-methyl-1,3-dioxo-isoindoline-5-carboxylic acid