CAS 427878-70-4 appears in our catalog under these names: Ethyl 5-methyl-4-oxo-1,4-dihydropyrrolo(2,1-f)(1,2,4)triazine-6-carboxylate, 97%, Ethyl 5-methyl-4-oxo-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 97%, 97%, Ethyl 5-methyl-4-oxo-1,4-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 250mg, 1g.
Ethyl 5-methyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 427878-70-4) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: ethyl 5-methyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: XCUHVGKOOKXZNK-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | ethyl 5-methyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| InChIKey | XCUHVGKOOKXZNK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=C1C)C(=O)NC=N2 |
Computed by PubChem (NCBI)