CAS 428838-49-7 appears in our catalog under these names: 2-(2-Bromo-4-formylphenoxy)acetic acid, 2-(2-Bromo-4-formylphenoxy)acetic acid 95%, 2-(2-Bromo-4-formylphenoxy)acetic acid, 95%, 95%, (2-Bromo-4-formylphenoxy)acetic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
2-(2-bromo-4-formylphenoxy)acetic acid (CAS 428838-49-7) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 2-(2-bromo-4-formylphenoxy)acetic acid. InChIKey: PGUJGPKJZJCFJB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 2-(2-bromo-4-formylphenoxy)acetic acid |
| InChIKey | PGUJGPKJZJCFJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Br)OCC(=O)O |
Computed by PubChem (NCBI)