CAS 42927-46-8 appears in our catalog under these names: (3R,4S,5R)-5-(Acetoxymethyl)tetrahydrofuran-2,3,4-triyl triacetate, 97%, D-Xylofuranose, 1,2,3,5-tetraacetate, 1,2,3,5–Tetra–O–acetyl–D–xylofuranose, 1,2,3,5-Tetra-o-acetyl-D-xylofuranose, D-Xylofuranose, 1,2,3,5-tetraacetate 98% HPLC. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g, 250g, 100mg.
[(2R,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 42927-46-8) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2R,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-DAAZQVBGSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | IHNHAHWGVLXCCI-DAAZQVBGSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)