Products 4367-49-1
CAS 4367-49-1 is the registry number for Clonquitocet-methyl, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
Methyl 2-(5-chloroquinolin-8-yl)oxyacetate (CAS 4367-49-1) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 2-(5-chloroquinolin-8-yl)oxyacetate. InChIKey: NDQZMBNEHYSVPL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 2-(5-chloroquinolin-8-yl)oxyacetate |
| InChIKey | NDQZMBNEHYSVPL-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=C2C(=C(C=C1)Cl)C=CC=N2 |
Computed by PubChem (NCBI)