CAS 436803-36-0 appears in our catalog under these names: 4-Bromo-5-methoxy-2,3-dihydro-1h-inden-1-one, 95%, 4-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 95-<97%, 4-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 4-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one 95+%, 4-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 95%+, 95%+. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 2,5g.
4-bromo-5-methoxy-2,3-dihydroinden-1-one (CAS 436803-36-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 4-bromo-5-methoxy-2,3-dihydroinden-1-one. InChIKey: ZVBMFHJZYVGNSX-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 4-bromo-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | ZVBMFHJZYVGNSX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)CC2)Br |
Computed by PubChem (NCBI)