CAS 4423-58-9 appears in our catalog under these names: Corynecin I, Corynecin I. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg.
N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide (CAS 4423-58-9) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide. InChIKey: PIVQDUYOEIAFDM-GHMZBOCLSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide |
| InChIKey | PIVQDUYOEIAFDM-GHMZBOCLSA-N |
| SMILES | CC(=O)N[C@H](CO)[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)