CAS 4506-45-0 appears in our catalog under these names: 5–Chloro–2–formylbenzoic acid, 5-Chloro-2-formylbenzoic acid 97%, 5-Chloro-2-formylbenzoic acid, 97%, 97%, 5-Chloro-2-formyl-benzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg.
5-chloro-2-formylbenzoic acid (CAS 4506-45-0) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 5-chloro-2-formylbenzoic acid. InChIKey: NQAMSLASTWZONN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 5-chloro-2-formylbenzoic acid |
| InChIKey | NQAMSLASTWZONN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)C=O |
Computed by PubChem (NCBI)