CAS 452340-95-3 is the registry number for tert-Butyl 2-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)-2-hydroxyethylcarbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]carbamate (CAS 452340-95-3) is a chemical compound with the molecular formula C17H25NO5 and a molecular weight of 323.4 g/mol. IUPAC name: tert-butyl N-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]carbamate. InChIKey: XBKHRWZUBFHWJU-UHFFFAOYSA-N.
| Molecular formula | C17H25NO5 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | tert-butyl N-[2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]carbamate |
| InChIKey | XBKHRWZUBFHWJU-UHFFFAOYSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(CNC(=O)OC(C)(C)C)O)C |
Computed by PubChem (NCBI)