Products 452341-63-8
CAS 452341-63-8 is the registry number for tert-Butyl Vinylsulfonylcarbamate. Offered by: TRC. Available pack sizes: 5g.
Tert-butyl N-ethenylsulfonylcarbamate (CAS 452341-63-8) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: tert-butyl N-ethenylsulfonylcarbamate. InChIKey: MIJVBDSRMVBYAS-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | tert-butyl N-ethenylsulfonylcarbamate |
| InChIKey | MIJVBDSRMVBYAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)C=C |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl vinylsulfonylcarbamate, tert-butyl N-ethenylsulfonylcarbamate, tert-Butyl (vinylsulfonyl)carbamate, Carbamic acid, (ethenylsulfonyl)-, 1,1-dimethylethyl ester (9CI), starbld0007388, MIJVBDSRMVBYAS-UHFFFAOYSA-N, 2-Methyl-2-propanyl (vinylsulfonyl)carbamate, (Ethenylsulfonyl)carbamic Acid 1,1-Dimethylethyl Ester