CAS 457654-76-1 appears in our catalog under these names: Methyl (S)-2-amino-3-(3-chlorophenyl)propanoate hydrochloride, 95%, methyl (2S)-2-amino-3-(3-chlorophenyl)propanoate hydrochloride, 98%, Methyl (S)-2-amino-3-(3-chlorophenyl)propanoate hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Methyl (2S)-2-amino-3-(3-chlorophenyl)propanoate;hydrochloride (CAS 457654-76-1) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-chlorophenyl)propanoate;hydrochloride. InChIKey: QDVSQQKLRHVYFU-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-chlorophenyl)propanoate;hydrochloride |
| InChIKey | QDVSQQKLRHVYFU-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=CC=C1)Cl)N.Cl |
Computed by PubChem (NCBI)