Products 4702-13-0
CAS 4702-13-0 appears in our catalog under these names: N-Phthaloylglycine, N–Phthaloylglycine, N-Phthaloylglycine, 98+% , N-Phthaloylglycine, >98.0%(HPLC)(T), N-Phthaloylglycine 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 10g, 25g, 1000g, 50g, 250g, 500g, 5g.
2-(1,3-dioxoisoindol-2-yl)acetic acid (CAS 4702-13-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)acetic acid. InChIKey: WQINSVOOIJDOLJ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)acetic acid |
| InChIKey | WQINSVOOIJDOLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)O |
Computed by PubChem (NCBI)